About 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride
5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride (PubChem CID 45265836) has the molecular formula C14H13ClN4O2
and a molecular weight of 304.74 g/mol. Its IUPAC name is 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride |
| PubChem CID | 45265836 |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride |
| SMILES | Cl.Nc1ccc(-n2cc(-c3cc(O)cc(O)c3)nn2)cc1 |
| InChI | InChI=1S/C14H12N4O2.ClH/c15-10-1-3-11(4-2-10)18-8-14(16-17-18)9-5-12(19)7-13(20)6-9;/h1-8,19-20H,15H2;1H |
| InChIKey | WJUQUHXZTDBQCE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride?
The IUPAC name of 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride (CID 45265836) is 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride.
What is the SMILES notation for 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride?
The canonical SMILES for 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride is Cl.Nc1ccc(-n2cc(-c3cc(O)cc(O)c3)nn2)cc1.
What is the InChIKey of 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride?
The InChIKey is WJUQUHXZTDBQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2.ClH/c15-10-1-3-11(4-2-10)18-8-14(16-17-18)9-5-12(19)7-13(20)6-9;/h1-8,19-20H,15H2;1H.
What are the key properties of 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride?
5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride has a molecular weight of 304.74 g/mol, XLogP of 2.35, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(4-aminophenyl)triazol-4-yl]benzene-1,3-diol;hydrochloride is sourced from PubChem (CID 45265836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).