C17H26ClNO — CID 45265873
(1R,2R,9aR)-2-ethyl-1-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride (PubChem CID 45265873) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is (1R,2R,9aR)-2-ethyl-1-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride.
| Compound Name | (1R,2R,9aR)-2-ethyl-1-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride |
|---|---|
| PubChem CID | 45265873 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (1R,2R,9aR)-2-ethyl-1-phenyl-1,3,4,6,7,8,9,9a-octahydroquinolizin-2-ol;hydrochloride |
| SMILES | CC[C@@]1(O)CCN2CCCC[C@@H]2[C@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C17H25NO.ClH/c1-2-17(19)11-13-18-12-7-6-10-15(18)16(17)14-8-4-3-5-9-14;/h3-5,8-9,15-16,19H,2,6-7,10-13H2,1H3;1H/t15-,16-,17-;/m1./s1 |
| InChIKey | LRCULZAWINWEES-UATJXVQHSA-N |
| XLogP | 3.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |