C26H36ClN11O3 — CID 45266044
N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxybenzamide;hydrochloride (PubChem CID 45266044) has the molecular formula C26H36ClN11O3 and a molecular weight of 586.10 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxybenzamide;hydrochloride.
| Compound Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 45266044 |
| Molecular Formula | C26H36ClN11O3 |
| Molecular Weight | 586.10 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxybenzamide;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4ccccc4O)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C26H35N11O3.ClH/c27-14-7-15(28)11-36(10-14)25-33-24(34-26(35-25)37-12-16(29)8-17(30)13-37)31-18-5-6-20(22(39)9-18)32-23(40)19-3-1-2-4-21(19)38;/h1-6,9,14-17,38-39H,7-8,10-13,27-30H2,(H,32,40)(H,31,33,34,35);1H/t14-,15+,16-,17+; |
| InChIKey | GCNZPZZIHGYIAD-NDJDMYCYSA-N |
| XLogP | 0.43 |
| TPSA | 230.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.10 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|