About 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride
1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride (PubChem CID 45266299) has the molecular formula C12H16ClNO2S
and a molecular weight of 273.78 g/mol. Its IUPAC name is 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride.
Molecular Properties
| Compound Name | 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride |
| PubChem CID | 45266299 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride |
| SMILES | O=C1CCC(=O)N1CC#CC[S+]1CCCC1.[Cl-] |
| InChI | InChI=1S/C12H16NO2S.ClH/c14-11-5-6-12(15)13(11)7-1-2-8-16-9-3-4-10-16;/h3-10H2;1H/q+1;/p-1 |
| InChIKey | JGQUBZMZEMUNKY-UHFFFAOYSA-M |
| XLogP | -2.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride?
The IUPAC name of 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride (CID 45266299) is 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride.
What is the SMILES notation for 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride?
The canonical SMILES for 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride is O=C1CCC(=O)N1CC#CC[S+]1CCCC1.[Cl-].
What is the InChIKey of 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride?
The InChIKey is JGQUBZMZEMUNKY-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16NO2S.ClH/c14-11-5-6-12(15)13(11)7-1-2-8-16-9-3-4-10-16;/h3-10H2;1H/q+1;/p-1.
What are the key properties of 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride?
1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride has a molecular weight of 273.78 g/mol, XLogP of -2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(thiolan-1-ium-1-yl)but-2-ynyl]pyrrolidine-2,5-dione chloride is sourced from PubChem (CID 45266299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).