About 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride
4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride (PubChem CID 45266300) has the molecular formula C10H14ClNO2S
and a molecular weight of 247.75 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride.
Molecular Properties
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride |
| PubChem CID | 45266300 |
| Molecular Formula | C10H14ClNO2S |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride |
| SMILES | C[S+](C)CC#CCN1C(=O)CCC1=O.[Cl-] |
| InChI | InChI=1S/C10H14NO2S.ClH/c1-14(2)8-4-3-7-11-9(12)5-6-10(11)13;/h5-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SNONJJUMCAPGAJ-UHFFFAOYSA-M |
| XLogP | -2.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride?
The IUPAC name of 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride (CID 45266300) is 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride.
What is the SMILES notation for 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride?
The canonical SMILES for 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride is C[S+](C)CC#CCN1C(=O)CCC1=O.[Cl-].
What is the InChIKey of 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride?
The InChIKey is SNONJJUMCAPGAJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14NO2S.ClH/c1-14(2)8-4-3-7-11-9(12)5-6-10(11)13;/h5-8H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride?
4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride has a molecular weight of 247.75 g/mol, XLogP of -2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrolidin-1-yl)but-2-ynyl-dimethylsulfanium chloride is sourced from PubChem (CID 45266300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).