About [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide
[(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide (PubChem CID 45266332) has the molecular formula C20H26INO2
and a molecular weight of 439.34 g/mol. Its IUPAC name is [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide.
Molecular Properties
| Compound Name | [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide |
| PubChem CID | 45266332 |
| Molecular Formula | C20H26INO2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide |
| SMILES | C[C@@H](C1COC(c2ccccc2)(c2ccccc2)O1)[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C20H26NO2.HI/c1-16(21(2,3)4)19-15-22-20(23-19,17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,16,19H,15H2,1-4H3;1H/q+1;/p-1/t16-,19?;/m0./s1 |
| InChIKey | PNMNYSZDIRAWFC-IFWFERPOSA-M |
| XLogP | 0.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide?
The IUPAC name of [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide (CID 45266332) is [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide.
What is the SMILES notation for [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide?
The canonical SMILES for [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide is C[C@@H](C1COC(c2ccccc2)(c2ccccc2)O1)[N+](C)(C)C.[I-].
What is the InChIKey of [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide?
The InChIKey is PNMNYSZDIRAWFC-IFWFERPOSA-M. The full InChI is InChI=1S/C20H26NO2.HI/c1-16(21(2,3)4)19-15-22-20(23-19,17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,16,19H,15H2,1-4H3;1H/q+1;/p-1/t16-,19?;/m0./s1.
What are the key properties of [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide?
[(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide has a molecular weight of 439.34 g/mol, XLogP of 0.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(2,2-diphenyl-1,3-dioxolan-4-yl)ethyl]-trimethylazanium iodide is sourced from PubChem (CID 45266332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).