C33H29ClN2S2 — CID 45266482
(2E)-3-ethyl-2-[(E)-3-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]benzo[g][1,3]benzothiazole chloride (PubChem CID 45266482) has the molecular formula C33H29ClN2S2 and a molecular weight of 553.20 g/mol. Its IUPAC name is (2E)-3-ethyl-2-[(E)-3-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]benzo[g][1,3]benzothiazole chloride.
| Compound Name | (2E)-3-ethyl-2-[(E)-3-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]benzo[g][1,3]benzothiazole chloride |
|---|---|
| PubChem CID | 45266482 |
| Molecular Formula | C33H29ClN2S2 |
| Molecular Weight | 553.20 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | (2E)-3-ethyl-2-[(E)-3-(3-ethyl-4,5-diphenyl-1,3-thiazol-3-ium-2-yl)prop-2-enylidene]benzo[g][1,3]benzothiazole chloride |
| SMILES | CCN1/C(=C\C=C\c2sc(-c3ccccc3)c(-c3ccccc3)[n+]2CC)Sc2c1ccc1ccccc21.[Cl-] |
| InChI | InChI=1S/C33H29N2S2.ClH/c1-3-34-28-23-22-24-14-11-12-19-27(24)33(28)37-29(34)20-13-21-30-35(4-2)31(25-15-7-5-8-16-25)32(36-30)26-17-9-6-10-18-26;/h5-23H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XMUPGSHCCWRJKT-UHFFFAOYSA-M |
| XLogP | 6.03 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.20 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|