C18H27O3- — CID 45266620
8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoate (PubChem CID 45266620) has the molecular formula C18H27O3- and a molecular weight of 291.41 g/mol. Its IUPAC name is 8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoate.
| Compound Name | 8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoate |
|---|---|
| PubChem CID | 45266620 |
| Molecular Formula | C18H27O3- |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoate |
| SMILES | CC/C=C\C[C@@H]1C(=O)C=C[C@@H]1CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H28O3/c1-2-3-7-11-16-15(13-14-17(16)19)10-8-5-4-6-9-12-18(20)21/h3,7,13-16H,2,4-6,8-12H2,1H3,(H,20,21)/p-1/b7-3-/t15-,16-/m0/s1 |
| InChIKey | PMTMAFAPLCGXGK-JMTMCXQRSA-M |
| XLogP | 3.19 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|