C8H14NO9P-2 — CID 45266685
[(2R,3S,4R,5S)-5-acetamido-2,3,4-trihydroxy-6-oxohexyl] phosphate (PubChem CID 45266685) has the molecular formula C8H14NO9P-2 and a molecular weight of 299.17 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-acetamido-2,3,4-trihydroxy-6-oxohexyl] phosphate.
| Compound Name | [(2R,3S,4R,5S)-5-acetamido-2,3,4-trihydroxy-6-oxohexyl] phosphate |
|---|---|
| PubChem CID | 45266685 |
| Molecular Formula | C8H14NO9P-2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | [(2R,3S,4R,5S)-5-acetamido-2,3,4-trihydroxy-6-oxohexyl] phosphate |
| SMILES | CC(=O)N[C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C8H16NO9P/c1-4(11)9-5(2-10)7(13)8(14)6(12)3-18-19(15,16)17/h2,5-8,12-14H,3H2,1H3,(H,9,11)(H2,15,16,17)/p-2/t5-,6-,7-,8-/m1/s1 |
| InChIKey | QDSLHWJDSQGPEE-WCTZXXKLSA-L |
| XLogP | -4.38 |
| TPSA | 179.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|