About (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate
(2R)-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 45266718) has the molecular formula C5H6NO2-
and a molecular weight of 112.11 g/mol. Its IUPAC name is (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate |
| PubChem CID | 45266718 |
| Molecular Formula | C5H6NO2- |
| Molecular Weight | 112.11 g/mol |
| Exact Mass | 112.04 |
| IUPAC Name | (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate |
| SMILES | O=C([O-])[C@H]1CCC=N1 |
| InChI | InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8)/p-1/t4-/m1/s1 |
| InChIKey | DWAKNKKXGALPNW-SCSAIBSYSA-M |
| XLogP | -1.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.11 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate?
The IUPAC name of (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate (CID 45266718) is (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate.
What is the SMILES notation for (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate?
The canonical SMILES for (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate is O=C([O-])[C@H]1CCC=N1.
What is the InChIKey of (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate?
The InChIKey is DWAKNKKXGALPNW-SCSAIBSYSA-M. The full InChI is InChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8)/p-1/t4-/m1/s1.
What are the key properties of (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate?
(2R)-3,4-dihydro-2H-pyrrole-2-carboxylate has a molecular weight of 112.11 g/mol, XLogP of -1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,4-dihydro-2H-pyrrole-2-carboxylate is sourced from PubChem (CID 45266718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).