C7H7O4- — CID 45266758
(5S,6S)-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 45266758) has the molecular formula C7H7O4- and a molecular weight of 155.13 g/mol. Its IUPAC name is (5S,6S)-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | (5S,6S)-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 45266758 |
| Molecular Formula | C7H7O4- |
| Molecular Weight | 155.13 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | (5S,6S)-5,6-dihydroxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | O=C([O-])C1=CC=C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H8O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,5-6,8-9H,(H,10,11)/p-1/t5-,6-/m0/s1 |
| InChIKey | INCSWYKICIYAHB-WDSKDSINSA-M |
| XLogP | -2.05 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.13 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |