C6H8NO2- — CID 45266761
(2S)-2,3,4,5-tetrahydropyridine-2-carboxylate (PubChem CID 45266761) has the molecular formula C6H8NO2- and a molecular weight of 126.13 g/mol. Its IUPAC name is (2S)-2,3,4,5-tetrahydropyridine-2-carboxylate.
| Compound Name | (2S)-2,3,4,5-tetrahydropyridine-2-carboxylate |
|---|---|
| PubChem CID | 45266761 |
| Molecular Formula | C6H8NO2- |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | (2S)-2,3,4,5-tetrahydropyridine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCCC=N1 |
| InChI | InChI=1S/C6H9NO2/c8-6(9)5-3-1-2-4-7-5/h4-5H,1-3H2,(H,8,9)/p-1/t5-/m0/s1 |
| InChIKey | CSDPVAKVEWETFG-YFKPBYRVSA-M |
| XLogP | -0.64 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |