About (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate
(5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate (PubChem CID 45266877) has the molecular formula C14H18O5S
and a molecular weight of 298.36 g/mol. Its IUPAC name is (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate |
| PubChem CID | 45266877 |
| Molecular Formula | C14H18O5S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C14H18O5S/c1-10-4-6-12(7-5-10)20(16,17)18-9-11-8-14(2,3)19-13(11)15/h4-7,11H,8-9H2,1-3H3 |
| InChIKey | KPFZKOVGENAVRB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate?
The IUPAC name of (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate (CID 45266877) is (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate.
What is the SMILES notation for (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate?
The canonical SMILES for (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2CC(C)(C)OC2=O)cc1.
What is the InChIKey of (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate?
The InChIKey is KPFZKOVGENAVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5S/c1-10-4-6-12(7-5-10)20(16,17)18-9-11-8-14(2,3)19-13(11)15/h4-7,11H,8-9H2,1-3H3.
What are the key properties of (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate?
(5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate has a molecular weight of 298.36 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-dimethyl-2-oxooxolan-3-yl)methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 45266877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).