C27H19F4N5O — CID 45266936
1-[3-[5-(3-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-3-[2-fluoro-4-(trifluoromethyl)phenyl]urea (PubChem CID 45266936) has the molecular formula C27H19F4N5O and a molecular weight of 505.48 g/mol. Its IUPAC name is 1-[3-[5-(3-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-3-[2-fluoro-4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[5-(3-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-3-[2-fluoro-4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 45266936 |
| Molecular Formula | C27H19F4N5O |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 1-[3-[5-(3-aminophenyl)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-3-[2-fluoro-4-(trifluoromethyl)phenyl]urea |
| SMILES | Nc1cccc(-c2cnc3[nH]cc(-c4cccc(NC(=O)Nc5ccc(C(F)(F)F)cc5F)c4)c3c2)c1 |
| InChI | InChI=1S/C27H19F4N5O/c28-23-12-18(27(29,30)31)7-8-24(23)36-26(37)35-20-6-2-4-16(10-20)22-14-34-25-21(22)11-17(13-33-25)15-3-1-5-19(32)9-15/h1-14H,32H2,(H,33,34)(H2,35,36,37) |
| InChIKey | JOMWSHSKTIDLKD-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|