C15H24O3 — CID 45267094
(1R,2R,4S,5Z,9S)-4-hydroxy-2-(hydroxymethyl)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-3-one (PubChem CID 45267094) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,2R,4S,5Z,9S)-4-hydroxy-2-(hydroxymethyl)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-3-one.
| Compound Name | (1R,2R,4S,5Z,9S)-4-hydroxy-2-(hydroxymethyl)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-3-one |
|---|---|
| PubChem CID | 45267094 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,2R,4S,5Z,9S)-4-hydroxy-2-(hydroxymethyl)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-3-one |
| SMILES | C/C1=C/[C@H](O)C(=O)[C@@H](CO)[C@@H]2CC(C)(C)[C@H]2CC1 |
| InChI | InChI=1S/C15H24O3/c1-9-4-5-12-10(7-15(12,2)3)11(8-16)14(18)13(17)6-9/h6,10-13,16-17H,4-5,7-8H2,1-3H3/b9-6-/t10-,11-,12-,13-/m0/s1 |
| InChIKey | QTBPNYPDBIVMPW-ZXQNTJINSA-N |
| XLogP | 1.93 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|