C17H22O7 — CID 45267170
(E)-4-(4-methoxyphenyl)-1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-en-2-one (PubChem CID 45267170) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is (E)-4-(4-methoxyphenyl)-1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-en-2-one.
| Compound Name | (E)-4-(4-methoxyphenyl)-1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 45267170 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (E)-4-(4-methoxyphenyl)-1-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-en-2-one |
| SMILES | COc1ccc(/C=C/C(=O)C[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C17H22O7/c1-23-12-6-3-10(4-7-12)2-5-11(19)8-13-15(20)17(22)16(21)14(9-18)24-13/h2-7,13-18,20-22H,8-9H2,1H3/b5-2+/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | FKXCYIJUJPLFPG-VYKJEPLOSA-N |
| XLogP | -0.49 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|