About 2-piperidin-1-ylethyl 2,2-diphenylpropanoate
2-piperidin-1-ylethyl 2,2-diphenylpropanoate (PubChem CID 45267219) has the molecular formula C22H27NO2
and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2,2-diphenylpropanoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 2,2-diphenylpropanoate |
| PubChem CID | 45267219 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-piperidin-1-ylethyl 2,2-diphenylpropanoate |
| SMILES | CC(C(=O)OCCN1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO2/c1-22(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21(24)25-18-17-23-15-9-4-10-16-23/h2-3,5-8,11-14H,4,9-10,15-18H2,1H3 |
| InChIKey | ROPNSRJSKHNKQZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-1-ylethyl 2,2-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 2,2-diphenylpropanoate?
The IUPAC name of 2-piperidin-1-ylethyl 2,2-diphenylpropanoate (CID 45267219) is 2-piperidin-1-ylethyl 2,2-diphenylpropanoate.
What is the SMILES notation for 2-piperidin-1-ylethyl 2,2-diphenylpropanoate?
The canonical SMILES for 2-piperidin-1-ylethyl 2,2-diphenylpropanoate is CC(C(=O)OCCN1CCCCC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-piperidin-1-ylethyl 2,2-diphenylpropanoate?
The InChIKey is ROPNSRJSKHNKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO2/c1-22(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21(24)25-18-17-23-15-9-4-10-16-23/h2-3,5-8,11-14H,4,9-10,15-18H2,1H3.
What are the key properties of 2-piperidin-1-ylethyl 2,2-diphenylpropanoate?
2-piperidin-1-ylethyl 2,2-diphenylpropanoate has a molecular weight of 337.46 g/mol, XLogP of 4.02, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 2,2-diphenylpropanoate is sourced from PubChem (CID 45267219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).