About (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol
(3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 45267246) has the molecular formula C16H15ClO2
and a molecular weight of 274.75 g/mol. Its IUPAC name is (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 45267246 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1c2cc(Cl)ccc2OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H15ClO2/c17-13-6-7-15-14(9-13)16(18)12(10-19-15)8-11-4-2-1-3-5-11/h1-7,9,12,16,18H,8,10H2/t12-,16-/m1/s1 |
| InChIKey | RUDWILLIGHIEBP-MLGOLLRUSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol (CID 45267246) is (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol is O[C@H]1c2cc(Cl)ccc2OC[C@H]1Cc1ccccc1.
What is the InChIKey of (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is RUDWILLIGHIEBP-MLGOLLRUSA-N. The full InChI is InChI=1S/C16H15ClO2/c17-13-6-7-15-14(9-13)16(18)12(10-19-15)8-11-4-2-1-3-5-11/h1-7,9,12,16,18H,8,10H2/t12-,16-/m1/s1.
What are the key properties of (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol?
(3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 274.75 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 45267246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).