C36H58N4O7 — CID 45267266
ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[8-(phenylmethoxycarbonylamino)octanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate (PubChem CID 45267266) has the molecular formula C36H58N4O7 and a molecular weight of 658.88 g/mol. Its IUPAC name is ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[8-(phenylmethoxycarbonylamino)octanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[8-(phenylmethoxycarbonylamino)octanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 45267266 |
| Molecular Formula | C36H58N4O7 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.43 |
| IUPAC Name | ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[8-(phenylmethoxycarbonylamino)octanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate |
| SMILES | C=COC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)CCCCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H58N4O7/c1-8-46-35(44)31(23-27(6)7)40-34(43)30(22-26(4)5)39-33(42)29(21-25(2)3)38-32(41)19-15-10-9-11-16-20-37-36(45)47-24-28-17-13-12-14-18-28/h8,12-14,17-18,25-27,29-31H,1,9-11,15-16,19-24H2,2-7H3,(H,37,45)(H,38,41)(H,39,42)(H,40,43)/t29-,30-,31-/m0/s1 |
| InChIKey | IYJRHJSRTSSFHZ-CHQNGUEUSA-N |
| XLogP | 5.53 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|