About 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine
1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine (PubChem CID 45267357) has the molecular formula C17H17N5O4S
and a molecular weight of 387.42 g/mol. Its IUPAC name is 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine |
| PubChem CID | 45267357 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)n1ccc2ncc(N3CCNCC3)cc21 |
| InChI | InChI=1S/C17H17N5O4S/c23-22(24)15-3-1-2-4-17(15)27(25,26)21-8-5-14-16(21)11-13(12-19-14)20-9-6-18-7-10-20/h1-5,8,11-12,18H,6-7,9-10H2 |
| InChIKey | FCSNTQYNAGFBNS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine?
The IUPAC name of 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine (CID 45267357) is 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine.
What is the SMILES notation for 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine?
The canonical SMILES for 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine is O=[N+]([O-])c1ccccc1S(=O)(=O)n1ccc2ncc(N3CCNCC3)cc21.
What is the InChIKey of 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine?
The InChIKey is FCSNTQYNAGFBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O4S/c23-22(24)15-3-1-2-4-17(15)27(25,26)21-8-5-14-16(21)11-13(12-19-14)20-9-6-18-7-10-20/h1-5,8,11-12,18H,6-7,9-10H2.
What are the key properties of 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine?
1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine has a molecular weight of 387.42 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-nitrophenyl)sulfonyl-6-piperazin-1-ylpyrrolo[3,2-b]pyridine is sourced from PubChem (CID 45267357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).