C14H16N2O6 — CID 45267421
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(5-phenyl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol (PubChem CID 45267421) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(5-phenyl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(5-phenyl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 45267421 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-(5-phenyl-1,3,4-oxadiazol-2-yl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2nnc(-c3ccccc3)o2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H16N2O6/c17-6-8-9(18)10(19)11(20)12(21-8)14-16-15-13(22-14)7-4-2-1-3-5-7/h1-5,8-12,17-20H,6H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | MKDOCLRSYSSLSH-RMPHRYRLSA-N |
| XLogP | -0.75 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |