C19H22F3N5O — CID 45267531
(3R)-3-amino-1-[(2S)-2-[(pyrimidin-2-ylamino)methyl]pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 45267531) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is (3R)-3-amino-1-[(2S)-2-[(pyrimidin-2-ylamino)methyl]pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[(2S)-2-[(pyrimidin-2-ylamino)methyl]pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 45267531 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (3R)-3-amino-1-[(2S)-2-[(pyrimidin-2-ylamino)methyl]pyrrolidin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCC[C@H]1CNc1ncccn1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H22F3N5O/c20-15-10-17(22)16(21)8-12(15)7-13(23)9-18(28)27-6-1-3-14(27)11-26-19-24-4-2-5-25-19/h2,4-5,8,10,13-14H,1,3,6-7,9,11,23H2,(H,24,25,26)/t13-,14+/m1/s1 |
| InChIKey | DWDQEEKCGYZRIY-KGLIPLIRSA-N |
| XLogP | 2.26 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|