About 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one
2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one (PubChem CID 45267771) has the molecular formula C23H29N5O3
and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 45267771 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one |
| SMILES | CCCOCCn1c(=O)c(NCC2CCOCC2)nc2ccc(-c3ccncc3)nc21 |
| InChI | InChI=1S/C23H29N5O3/c1-2-12-30-15-11-28-22-20(4-3-19(27-22)18-5-9-24-10-6-18)26-21(23(28)29)25-16-17-7-13-31-14-8-17/h3-6,9-10,17H,2,7-8,11-16H2,1H3,(H,25,26) |
| InChIKey | WFHWZZABOMLYBG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one (CID 45267771) is 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one is CCCOCCn1c(=O)c(NCC2CCOCC2)nc2ccc(-c3ccncc3)nc21.
What is the InChIKey of 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one?
The InChIKey is WFHWZZABOMLYBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N5O3/c1-2-12-30-15-11-28-22-20(4-3-19(27-22)18-5-9-24-10-6-18)26-21(23(28)29)25-16-17-7-13-31-14-8-17/h3-6,9-10,17H,2,7-8,11-16H2,1H3,(H,25,26).
What are the key properties of 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one?
2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one has a molecular weight of 423.52 g/mol, XLogP of 3.12, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-ylmethylamino)-4-(2-propoxyethyl)-6-pyridin-4-ylpyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 45267771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).