C20H35N3 — CID 45267778
1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)-5-pentyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine (PubChem CID 45267778) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)-5-pentyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine.
| Compound Name | 1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)-5-pentyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 45267778 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | 1-(cyclopropylmethyl)-2-(2,2-dimethylpropyl)-5-pentyl-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
| SMILES | CCCCCN1CCc2c(nc(CC(C)(C)C)n2CC2CC2)C1 |
| InChI | InChI=1S/C20H35N3/c1-5-6-7-11-22-12-10-18-17(15-22)21-19(13-20(2,3)4)23(18)14-16-8-9-16/h16H,5-15H2,1-4H3 |
| InChIKey | CLZIVSVDBVEUFG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|