C13H15ClN2 — CID 45267781
3-(4-chlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-indazole (PubChem CID 45267781) has the molecular formula C13H15ClN2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-indazole.
| Compound Name | 3-(4-chlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-indazole |
|---|---|
| PubChem CID | 45267781 |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(4-chlorophenyl)-3,3a,4,5,6,7-hexahydro-2H-indazole |
| SMILES | Clc1ccc(C2NN=C3CCCCC32)cc1 |
| InChI | InChI=1S/C13H15ClN2/c14-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)15-16-13/h5-8,11,13,16H,1-4H2 |
| InChIKey | WMORHWXOUHZOQJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |