C40H54N2O4 — CID 45267915
[(1S,3R,6S,7S,11S,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7-(hydroxymethyl)-7,12,16-trimethyl-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] benzoate (PubChem CID 45267915) has the molecular formula C40H54N2O4 and a molecular weight of 626.88 g/mol. Its IUPAC name is [(1S,3R,6S,7S,11S,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7-(hydroxymethyl)-7,12,16-trimethyl-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] benzoate.
| Compound Name | [(1S,3R,6S,7S,11S,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7-(hydroxymethyl)-7,12,16-trimethyl-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] benzoate |
|---|---|
| PubChem CID | 45267915 |
| Molecular Formula | C40H54N2O4 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.41 |
| IUPAC Name | [(1S,3R,6S,7S,11S,12S,14R,15S,16R)-6-benzamido-15-[(1S)-1-(dimethylamino)ethyl]-7-(hydroxymethyl)-7,12,16-trimethyl-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] benzoate |
| SMILES | C[C@@H]([C@H]1[C@H](OC(=O)c2ccccc2)C[C@@]2(C)[C@@H]3CCC4[C@@]5(CC[C@H](NC(=O)c6ccccc6)[C@@]4(C)CO)C[C@@]35CC[C@]12C)N(C)C |
| InChI | InChI=1S/C40H54N2O4/c1-26(42(5)6)33-29(46-35(45)28-15-11-8-12-16-28)23-38(4)31-18-17-30-36(2,25-43)32(41-34(44)27-13-9-7-10-14-27)19-20-39(30)24-40(31,39)22-21-37(33,38)3/h7-16,26,29-33,43H,17-25H2,1-6H3,(H,41,44)/t26-,29+,30?,31-,32-,33-,36-,37+,38-,39+,40-/m0/s1 |
| InChIKey | BGXQOXKJFCPHSX-KOLHAFENSA-N |
| XLogP | 6.98 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |