C23H30N6O5S — CID 45267973
2-amino-4-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-phenylpropylamino)purin-9-yl]oxolan-2-yl]methylsulfanyl]butanoic acid (PubChem CID 45267973) has the molecular formula C23H30N6O5S and a molecular weight of 502.60 g/mol. Its IUPAC name is 2-amino-4-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-phenylpropylamino)purin-9-yl]oxolan-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-phenylpropylamino)purin-9-yl]oxolan-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 45267973 |
| Molecular Formula | C23H30N6O5S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-amino-4-[[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(3-phenylpropylamino)purin-9-yl]oxolan-2-yl]methylsulfanyl]butanoic acid |
| SMILES | NC(CCSC[C@H]1O[C@@H](n2cnc3c(NCCCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C23H30N6O5S/c24-15(23(32)33)8-10-35-11-16-18(30)19(31)22(34-16)29-13-28-17-20(26-12-27-21(17)29)25-9-4-7-14-5-2-1-3-6-14/h1-3,5-6,12-13,15-16,18-19,22,30-31H,4,7-11,24H2,(H,32,33)(H,25,26,27)/t15?,16-,18-,19-,22-/m1/s1 |
| InChIKey | QAVAAPUGVSFKKD-SYDIUPFYSA-N |
| XLogP | 1.03 |
| TPSA | 168.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|