C20H18N8OS — CID 45268050
N-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]thiadiazole-4-carboxamide (PubChem CID 45268050) has the molecular formula C20H18N8OS and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]thiadiazole-4-carboxamide.
| Compound Name | N-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 45268050 |
| Molecular Formula | C20H18N8OS |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[[3-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]thiadiazole-4-carboxamide |
| SMILES | CNc1nc2[nH]c(-c3cccc(CNC(=O)c4csnn4)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C20H18N8OS/c1-21-19-16-17(28(2)10-23-16)13-7-14(24-18(13)25-19)12-5-3-4-11(6-12)8-22-20(29)15-9-30-27-26-15/h3-7,9-10H,8H2,1-2H3,(H,22,29)(H2,21,24,25) |
| InChIKey | MFIHEMURNUGWKL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |