C22H27N7O4 — CID 45268077
2-[2-[[1,5-bis[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine (PubChem CID 45268077) has the molecular formula C22H27N7O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-[2-[[1,5-bis[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[1,5-bis[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 45268077 |
| Molecular Formula | C22H27N7O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 2-[2-[[1,5-bis[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]guanidine |
| SMILES | COc1ccc(Cn2c(NCCN=C(N)N)nc(=O)n(Cc3ccc(OC)cc3)c2=O)cc1 |
| InChI | InChI=1S/C22H27N7O4/c1-32-17-7-3-15(4-8-17)13-28-20(26-12-11-25-19(23)24)27-21(30)29(22(28)31)14-16-5-9-18(33-2)10-6-16/h3-10H,11-14H2,1-2H3,(H4,23,24,25)(H,26,27,30) |
| InChIKey | SOODERUJPIUHDK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|