C23H24F3N5O3 — CID 45268151
2-[2-[4-[[6-(5-methyl-2-pyridinyl)-3-pyridinyl]methoxy]phenyl]ethyl]guanidine;2,2,2-trifluoroacetic acid (PubChem CID 45268151) has the molecular formula C23H24F3N5O3 and a molecular weight of 475.47 g/mol. Its IUPAC name is 2-[2-[4-[[6-(5-methyl-2-pyridinyl)-3-pyridinyl]methoxy]phenyl]ethyl]guanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[4-[[6-(5-methyl-2-pyridinyl)-3-pyridinyl]methoxy]phenyl]ethyl]guanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45268151 |
| Molecular Formula | C23H24F3N5O3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[2-[4-[[6-(5-methyl-2-pyridinyl)-3-pyridinyl]methoxy]phenyl]ethyl]guanidine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(-c2ccc(COc3ccc(CCN=C(N)N)cc3)cn2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23N5O.C2HF3O2/c1-15-2-8-19(25-12-15)20-9-5-17(13-26-20)14-27-18-6-3-16(4-7-18)10-11-24-21(22)23;3-2(4,5)1(6)7/h2-9,12-13H,10-11,14H2,1H3,(H4,22,23,24);(H,6,7) |
| InChIKey | DSZCPZAPOXIWAM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|