About 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one
3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 45268156) has the molecular formula C12H15ClN2O
and a molecular weight of 238.72 g/mol. Its IUPAC name is 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one |
| PubChem CID | 45268156 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | CCC(C)C1Nc2cc(Cl)ccc2NC1=O |
| InChI | InChI=1S/C12H15ClN2O/c1-3-7(2)11-12(16)15-9-5-4-8(13)6-10(9)14-11/h4-7,11,14H,3H2,1-2H3,(H,15,16) |
| InChIKey | PRGHPGHBOZRTJO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one?
The IUPAC name of 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one (CID 45268156) is 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one.
What is the SMILES notation for 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one?
The canonical SMILES for 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one is CCC(C)C1Nc2cc(Cl)ccc2NC1=O.
What is the InChIKey of 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one?
The InChIKey is PRGHPGHBOZRTJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O/c1-3-7(2)11-12(16)15-9-5-4-8(13)6-10(9)14-11/h4-7,11,14H,3H2,1-2H3,(H,15,16).
What are the key properties of 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one?
3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one has a molecular weight of 238.72 g/mol, XLogP of 3.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-6-chloro-3,4-dihydro-1H-quinoxalin-2-one is sourced from PubChem (CID 45268156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).