About 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid
2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid (PubChem CID 45268160) has the molecular formula C15H12Cl2O2
and a molecular weight of 295.17 g/mol. Its IUPAC name is 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid |
| PubChem CID | 45268160 |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H12Cl2O2/c16-13-6-3-7-14(17)12(13)8-10-4-1-2-5-11(10)9-15(18)19/h1-7H,8-9H2,(H,18,19) |
| InChIKey | JJQADDQPQKGVLH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid?
The IUPAC name of 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid (CID 45268160) is 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid.
What is the SMILES notation for 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid?
The canonical SMILES for 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid is O=C(O)Cc1ccccc1Cc1c(Cl)cccc1Cl.
What is the InChIKey of 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid?
The InChIKey is JJQADDQPQKGVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2O2/c16-13-6-3-7-14(17)12(13)8-10-4-1-2-5-11(10)9-15(18)19/h1-7H,8-9H2,(H,18,19).
What are the key properties of 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid?
2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid has a molecular weight of 295.17 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetic acid is sourced from PubChem (CID 45268160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).