C19H13ClF2N6O2 — CID 45268191
2-(2-chloro-3,6-difluorophenoxy)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine (PubChem CID 45268191) has the molecular formula C19H13ClF2N6O2 and a molecular weight of 430.80 g/mol. Its IUPAC name is 2-(2-chloro-3,6-difluorophenoxy)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine.
| Compound Name | 2-(2-chloro-3,6-difluorophenoxy)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine |
|---|---|
| PubChem CID | 45268191 |
| Molecular Formula | C19H13ClF2N6O2 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-(2-chloro-3,6-difluorophenoxy)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine |
| SMILES | COc1ccc(-n2c(C)nnc2-c2cnc(Oc3c(F)ccc(F)c3Cl)cn2)cn1 |
| InChI | InChI=1S/C19H13ClF2N6O2/c1-10-26-27-19(28(10)11-3-6-15(29-2)24-7-11)14-8-25-16(9-23-14)30-18-13(22)5-4-12(21)17(18)20/h3-9H,1-2H3 |
| InChIKey | QLDWXKVICGHVJW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|