C32H26ClN3O3 — CID 45268266
3-[5-[[2-(7-chloroquinolin-2-yl)-1-benzofuran-5-yl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]propanoic acid (PubChem CID 45268266) has the molecular formula C32H26ClN3O3 and a molecular weight of 536.03 g/mol. Its IUPAC name is 3-[5-[[2-(7-chloroquinolin-2-yl)-1-benzofuran-5-yl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]propanoic acid.
| Compound Name | 3-[5-[[2-(7-chloroquinolin-2-yl)-1-benzofuran-5-yl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 45268266 |
| Molecular Formula | C32H26ClN3O3 |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | 3-[5-[[2-(7-chloroquinolin-2-yl)-1-benzofuran-5-yl]methyl]-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCc2c(c3ccccc3n2Cc2ccc3oc(-c4ccc5ccc(Cl)cc5n4)cc3c2)C1 |
| InChI | InChI=1S/C32H26ClN3O3/c33-23-8-6-21-7-9-26(34-27(21)17-23)31-16-22-15-20(5-10-30(22)39-31)18-36-28-4-2-1-3-24(28)25-19-35(13-11-29(25)36)14-12-32(37)38/h1-10,15-17H,11-14,18-19H2,(H,37,38) |
| InChIKey | ABOXSYZUZSDMTI-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|