C24H46O7 — CID 45268273
[(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] (Z)-octadec-9-enoate (PubChem CID 45268273) has the molecular formula C24H46O7 and a molecular weight of 446.63 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 45268273 |
| Molecular Formula | C24H46O7 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C24H46O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(28)31-19-21(27)24(30)23(29)20(26)18-25/h9-10,20-21,23-27,29-30H,2-8,11-19H2,1H3/b10-9-/t20-,21+,23+,24+/m0/s1 |
| InChIKey | WERKSKAQRVDLDW-AAZCQSIUSA-N |
| XLogP | 3.00 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|