C30H33NaO4 — CID 45268278
sodium (E,3R,5S)-3,5-dihydroxy-7-[2-phenyl-4-(3-phenylpentan-3-yl)phenyl]hept-6-enoate (PubChem CID 45268278) has the molecular formula C30H33NaO4 and a molecular weight of 480.58 g/mol. Its IUPAC name is sodium (E,3R,5S)-3,5-dihydroxy-7-[2-phenyl-4-(3-phenylpentan-3-yl)phenyl]hept-6-enoate.
| Compound Name | sodium (E,3R,5S)-3,5-dihydroxy-7-[2-phenyl-4-(3-phenylpentan-3-yl)phenyl]hept-6-enoate |
|---|---|
| PubChem CID | 45268278 |
| Molecular Formula | C30H33NaO4 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | sodium (E,3R,5S)-3,5-dihydroxy-7-[2-phenyl-4-(3-phenylpentan-3-yl)phenyl]hept-6-enoate |
| SMILES | CCC(CC)(c1ccccc1)c1ccc(/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])c(-c2ccccc2)c1.[Na+] |
| InChI | InChI=1S/C30H34O4.Na/c1-3-30(4-2,24-13-9-6-10-14-24)25-17-15-23(28(19-25)22-11-7-5-8-12-22)16-18-26(31)20-27(32)21-29(33)34;/h5-19,26-27,31-32H,3-4,20-21H2,1-2H3,(H,33,34);/q;+1/p-1/b18-16+;/t26-,27-;/m1./s1 |
| InChIKey | IQCYDIGNIBPFQE-ZTTUPKNVSA-M |
| XLogP | 1.73 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |