methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate

C21H16N2O2 — CID 45268287

IUPACmethyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate
SMILESCOC(=O)c1ccc(-c2c[nH]c3ncc(-c4ccccc4)cc23)cc1
InChIInChI=1S/C21H16N2O2/c1-25-21(24)16-9-7-15(8-10-16)19-13-23-20-18(19)11-17(12-22-20)14-5-3-2-4-6-14/h2-13H,1H3,(H,22,23)
InChIKeyAXQNDKWNRKTQRF-UHFFFAOYSA-N
MW328.37 g/mol
LogP4.68
Rot. Bonds3

About methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate

methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate (PubChem CID 45268287) has the molecular formula C21H16N2O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate.

Molecular Properties

Compound Namemethyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate
PubChem CID45268287
Molecular FormulaC21H16N2O2
Molecular Weight328.37 g/mol
Exact Mass328.12
IUPAC Namemethyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate
SMILESCOC(=O)c1ccc(-c2c[nH]c3ncc(-c4ccccc4)cc23)cc1
InChIInChI=1S/C21H16N2O2/c1-25-21(24)16-9-7-15(8-10-16)19-13-23-20-18(19)11-17(12-22-20)14-5-3-2-4-6-14/h2-13H,1H3,(H,22,23)
InChIKeyAXQNDKWNRKTQRF-UHFFFAOYSA-N
XLogP4.68
TPSA54.98 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.37
LogP ≤ 54.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate?
The IUPAC name of methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate (CID 45268287) is methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate.
What is the SMILES notation for methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate?
The canonical SMILES for methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate is COC(=O)c1ccc(-c2c[nH]c3ncc(-c4ccccc4)cc23)cc1.
What is the InChIKey of methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate?
The InChIKey is AXQNDKWNRKTQRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O2/c1-25-21(24)16-9-7-15(8-10-16)19-13-23-20-18(19)11-17(12-22-20)14-5-3-2-4-6-14/h2-13H,1H3,(H,22,23).
What are the key properties of methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate?
methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate has a molecular weight of 328.37 g/mol, XLogP of 4.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoate is sourced from PubChem (CID 45268287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).