C26H26N6O3 — CID 45268316
3-(1-methylindol-3-yl)-4-[1-(3-morpholin-4-ylpropyl)pyrazolo[5,4-b]pyridin-3-yl]pyrrole-2,5-dione (PubChem CID 45268316) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-4-[1-(3-morpholin-4-ylpropyl)pyrazolo[5,4-b]pyridin-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1-methylindol-3-yl)-4-[1-(3-morpholin-4-ylpropyl)pyrazolo[5,4-b]pyridin-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 45268316 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 3-(1-methylindol-3-yl)-4-[1-(3-morpholin-4-ylpropyl)pyrazolo[5,4-b]pyridin-3-yl]pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3nn(CCCN4CCOCC4)c4ncccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C26H26N6O3/c1-30-16-19(17-6-2-3-8-20(17)30)21-22(26(34)28-25(21)33)23-18-7-4-9-27-24(18)32(29-23)11-5-10-31-12-14-35-15-13-31/h2-4,6-9,16H,5,10-15H2,1H3,(H,28,33,34) |
| InChIKey | UQOPLFRRDTXROR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|