About 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea
3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea (PubChem CID 45268404) has the molecular formula C21H25FN4O
and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea.
Molecular Properties
| Compound Name | 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea |
| PubChem CID | 45268404 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NCc1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H25FN4O/c1-3-11-25(12-4-2)21(27)23-14-16-5-10-20-17(13-16)15-24-26(20)19-8-6-18(22)7-9-19/h5-10,13,15H,3-4,11-12,14H2,1-2H3,(H,23,27) |
| InChIKey | BKYPFBBGDSHHFU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea?
The IUPAC name of 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea (CID 45268404) is 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea.
What is the SMILES notation for 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea?
The canonical SMILES for 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea is CCCN(CCC)C(=O)NCc1ccc2c(cnn2-c2ccc(F)cc2)c1.
What is the InChIKey of 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea?
The InChIKey is BKYPFBBGDSHHFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25FN4O/c1-3-11-25(12-4-2)21(27)23-14-16-5-10-20-17(13-16)15-24-26(20)19-8-6-18(22)7-9-19/h5-10,13,15H,3-4,11-12,14H2,1-2H3,(H,23,27).
What are the key properties of 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea?
3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea has a molecular weight of 368.46 g/mol, XLogP of 4.50, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(4-fluorophenyl)indazol-5-yl]methyl]-1,1-dipropylurea is sourced from PubChem (CID 45268404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).