C18H22O3 — CID 45268517
(5S)-5-methyl-5-phenylspiro[1,2,4-trioxolane-3,2'-adamantane] (PubChem CID 45268517) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (5S)-5-methyl-5-phenylspiro[1,2,4-trioxolane-3,2'-adamantane].
| Compound Name | (5S)-5-methyl-5-phenylspiro[1,2,4-trioxolane-3,2'-adamantane] |
|---|---|
| PubChem CID | 45268517 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (5S)-5-methyl-5-phenylspiro[1,2,4-trioxolane-3,2'-adamantane] |
| SMILES | C[C@@]1(c2ccccc2)OOC2(O1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C18H22O3/c1-17(14-5-3-2-4-6-14)19-18(21-20-17)15-8-12-7-13(10-15)11-16(18)9-12/h2-6,12-13,15-16H,7-11H2,1H3/t12?,13?,15?,16?,17-,18?/m0/s1 |
| InChIKey | KRZKVNBLQDLYQI-XEFPTXDNSA-N |
| XLogP | 3.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|