C22H24O5 — CID 45268588
(3aS,6S,6aS,9aS,9bR)-6a-hydroxy-8-[hydroxy(phenyl)methyl]-6,9a-dimethyl-3-methylidene-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-2,9-dione (PubChem CID 45268588) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is (3aS,6S,6aS,9aS,9bR)-6a-hydroxy-8-[hydroxy(phenyl)methyl]-6,9a-dimethyl-3-methylidene-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-2,9-dione.
| Compound Name | (3aS,6S,6aS,9aS,9bR)-6a-hydroxy-8-[hydroxy(phenyl)methyl]-6,9a-dimethyl-3-methylidene-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-2,9-dione |
|---|---|
| PubChem CID | 45268588 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (3aS,6S,6aS,9aS,9bR)-6a-hydroxy-8-[hydroxy(phenyl)methyl]-6,9a-dimethyl-3-methylidene-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan-2,9-dione |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1CC[C@H](C)[C@]1(O)C=C(C(O)c3ccccc3)C(=O)[C@@]21C |
| InChI | InChI=1S/C22H24O5/c1-12-9-10-15-13(2)20(25)27-19(15)21(3)18(24)16(11-22(12,21)26)17(23)14-7-5-4-6-8-14/h4-8,11-12,15,17,19,23,26H,2,9-10H2,1,3H3/t12-,15-,17?,19+,21-,22+/m0/s1 |
| InChIKey | PDKZCKXVSJGPRP-ZRXSYPKVSA-N |
| XLogP | 2.49 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|