About 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide
2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide (PubChem CID 45268686) has the molecular formula C20H15N3O2
and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide.
Molecular Properties
| Compound Name | 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide |
| PubChem CID | 45268686 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide |
| SMILES | NC(=O)c1ccccc1-c1ccc2c(c1)Nc1ccccc1NC2=O |
| InChI | InChI=1S/C20H15N3O2/c21-19(24)14-6-2-1-5-13(14)12-9-10-15-18(11-12)22-16-7-3-4-8-17(16)23-20(15)25/h1-11,22H,(H2,21,24)(H,23,25) |
| InChIKey | XLSKYJYTEGNOBA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide?
The IUPAC name of 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide (CID 45268686) is 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide.
What is the SMILES notation for 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide?
The canonical SMILES for 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide is NC(=O)c1ccccc1-c1ccc2c(c1)Nc1ccccc1NC2=O.
What is the InChIKey of 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide?
The InChIKey is XLSKYJYTEGNOBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O2/c21-19(24)14-6-2-1-5-13(14)12-9-10-15-18(11-12)22-16-7-3-4-8-17(16)23-20(15)25/h1-11,22H,(H2,21,24)(H,23,25).
What are the key properties of 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide?
2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide has a molecular weight of 329.36 g/mol, XLogP of 3.76, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepin-9-yl)benzamide is sourced from PubChem (CID 45268686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).