C37H39N5O10 — CID 45268692
2-[4-[2-acetamido-3-[[5-[[carboxy(1H-indol-3-yl)methyl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid (PubChem CID 45268692) has the molecular formula C37H39N5O10 and a molecular weight of 713.74 g/mol. Its IUPAC name is 2-[4-[2-acetamido-3-[[5-[[carboxy(1H-indol-3-yl)methyl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid.
| Compound Name | 2-[4-[2-acetamido-3-[[5-[[carboxy(1H-indol-3-yl)methyl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
|---|---|
| PubChem CID | 45268692 |
| Molecular Formula | C37H39N5O10 |
| Molecular Weight | 713.74 g/mol |
| Exact Mass | 713.27 |
| IUPAC Name | 2-[4-[2-acetamido-3-[[5-[[carboxy(1H-indol-3-yl)methyl]amino]-5-oxopentyl]amino]-3-oxopropyl]-2-ethyl-N-oxaloanilino]benzoic acid |
| SMILES | CCc1cc(CC(NC(C)=O)C(=O)NCCCCC(=O)NC(C(=O)O)c2c[nH]c3ccccc23)ccc1N(C(=O)C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C37H39N5O10/c1-3-23-18-22(15-16-29(23)42(34(46)37(51)52)30-13-7-5-11-25(30)35(47)48)19-28(40-21(2)43)33(45)38-17-9-8-14-31(44)41-32(36(49)50)26-20-39-27-12-6-4-10-24(26)27/h4-7,10-13,15-16,18,20,28,32,39H,3,8-9,14,17,19H2,1-2H3,(H,38,45)(H,40,43)(H,41,44)(H,47,48)(H,49,50)(H,51,52) |
| InChIKey | GAMJGDOTHYYIAO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 235.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|