C23H32O10 — CID 45268915
diethyl 2-[3-oxo-1-phenyl-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]propanedioate (PubChem CID 45268915) has the molecular formula C23H32O10 and a molecular weight of 468.50 g/mol. Its IUPAC name is diethyl 2-[3-oxo-1-phenyl-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]propanedioate.
| Compound Name | diethyl 2-[3-oxo-1-phenyl-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]propanedioate |
|---|---|
| PubChem CID | 45268915 |
| Molecular Formula | C23H32O10 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | diethyl 2-[3-oxo-1-phenyl-4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]butyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CC(=O)C[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C23H32O10/c1-3-31-22(29)18(23(30)32-4-2)15(13-8-6-5-7-9-13)10-14(25)11-16-19(26)21(28)20(27)17(12-24)33-16/h5-9,15-21,24,26-28H,3-4,10-12H2,1-2H3/t15?,16-,17+,19-,20+,21+/m0/s1 |
| InChIKey | RDWCZGNDHGWJRW-DXVIRTPJSA-N |
| XLogP | -0.30 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|