C38H46N4O6 — CID 45268946
N-[(2S)-3-(4-benzoylphenyl)-1-[[6-[(2S)-2-[(2S)-2-formylpyrrolidine-1-carbonyl]pyrrolidin-1-yl]-6-oxohexyl]amino]-1-oxopropan-2-yl]hex-5-ynamide (PubChem CID 45268946) has the molecular formula C38H46N4O6 and a molecular weight of 654.81 g/mol. Its IUPAC name is N-[(2S)-3-(4-benzoylphenyl)-1-[[6-[(2S)-2-[(2S)-2-formylpyrrolidine-1-carbonyl]pyrrolidin-1-yl]-6-oxohexyl]amino]-1-oxopropan-2-yl]hex-5-ynamide.
| Compound Name | N-[(2S)-3-(4-benzoylphenyl)-1-[[6-[(2S)-2-[(2S)-2-formylpyrrolidine-1-carbonyl]pyrrolidin-1-yl]-6-oxohexyl]amino]-1-oxopropan-2-yl]hex-5-ynamide |
|---|---|
| PubChem CID | 45268946 |
| Molecular Formula | C38H46N4O6 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | N-[(2S)-3-(4-benzoylphenyl)-1-[[6-[(2S)-2-[(2S)-2-formylpyrrolidine-1-carbonyl]pyrrolidin-1-yl]-6-oxohexyl]amino]-1-oxopropan-2-yl]hex-5-ynamide |
| SMILES | C#CCCCC(=O)N[C@@H](Cc1ccc(C(=O)c2ccccc2)cc1)C(=O)NCCCCCC(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C=O |
| InChI | InChI=1S/C38H46N4O6/c1-2-3-6-17-34(44)40-32(26-28-19-21-30(22-20-28)36(46)29-13-7-4-8-14-29)37(47)39-23-10-5-9-18-35(45)42-25-12-16-33(42)38(48)41-24-11-15-31(41)27-43/h1,4,7-8,13-14,19-22,27,31-33H,3,5-6,9-12,15-18,23-26H2,(H,39,47)(H,40,44)/t31-,32-,33-/m0/s1 |
| InChIKey | JWTFOTFQJMCLNW-ZDCRTTOTSA-N |
| XLogP | 3.61 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|