About quinolino[8,7-h]quinoline
quinolino[8,7-h]quinoline (PubChem CID 4526899) has the molecular formula C16H10N2
and a molecular weight of 230.27 g/mol. Its IUPAC name is quinolino[8,7-h]quinoline.
Molecular Properties
| Compound Name | quinolino[8,7-h]quinoline |
| PubChem CID | 4526899 |
| Molecular Formula | C16H10N2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | quinolino[8,7-h]quinoline |
| SMILES | c1cnc2c(c1)ccc1c2ccc2cccnc21 |
| InChI | InChI=1S/C16H10N2/c1-3-11-5-7-14-13(15(11)17-9-1)8-6-12-4-2-10-18-16(12)14/h1-10H |
| InChIKey | SEWFHKXOGALKAV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze quinolino[8,7-h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolino[8,7-h]quinoline?
The IUPAC name of quinolino[8,7-h]quinoline (CID 4526899) is quinolino[8,7-h]quinoline.
What is the SMILES notation for quinolino[8,7-h]quinoline?
The canonical SMILES for quinolino[8,7-h]quinoline is c1cnc2c(c1)ccc1c2ccc2cccnc21.
What is the InChIKey of quinolino[8,7-h]quinoline?
The InChIKey is SEWFHKXOGALKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2/c1-3-11-5-7-14-13(15(11)17-9-1)8-6-12-4-2-10-18-16(12)14/h1-10H.
What are the key properties of quinolino[8,7-h]quinoline?
quinolino[8,7-h]quinoline has a molecular weight of 230.27 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolino[8,7-h]quinoline is sourced from PubChem (CID 4526899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).