C34H54N4O7 — CID 45269016
ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[6-(phenylmethoxycarbonylamino)hexanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate (PubChem CID 45269016) has the molecular formula C34H54N4O7 and a molecular weight of 630.83 g/mol. Its IUPAC name is ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[6-(phenylmethoxycarbonylamino)hexanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[6-(phenylmethoxycarbonylamino)hexanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 45269016 |
| Molecular Formula | C34H54N4O7 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.40 |
| IUPAC Name | ethenyl (2S)-4-methyl-2-[[(2S)-4-methyl-2-[[(2S)-4-methyl-2-[6-(phenylmethoxycarbonylamino)hexanoylamino]pentanoyl]amino]pentanoyl]amino]pentanoate |
| SMILES | C=COC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)CCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H54N4O7/c1-8-44-33(42)29(21-25(6)7)38-32(41)28(20-24(4)5)37-31(40)27(19-23(2)3)36-30(39)17-13-10-14-18-35-34(43)45-22-26-15-11-9-12-16-26/h8-9,11-12,15-16,23-25,27-29H,1,10,13-14,17-22H2,2-7H3,(H,35,43)(H,36,39)(H,37,40)(H,38,41)/t27-,28-,29-/m0/s1 |
| InChIKey | IGKXBZICPMPKPG-AWCRTANDSA-N |
| XLogP | 4.75 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|