About N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide
N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide (PubChem CID 45269027) has the molecular formula C23H28ClN3O2
and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide |
| PubChem CID | 45269027 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-4-23(2,3)22(29)25-18-10-11-20(19(24)16-18)26-12-14-27(15-13-26)21(28)17-8-6-5-7-9-17/h5-11,16H,4,12-15H2,1-3H3,(H,25,29) |
| InChIKey | UJJAAJMQANNJBW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide?
The IUPAC name of N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide (CID 45269027) is N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide.
What is the SMILES notation for N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide?
The canonical SMILES for N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide is CCC(C)(C)C(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(Cl)c1.
What is the InChIKey of N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide?
The InChIKey is UJJAAJMQANNJBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClN3O2/c1-4-23(2,3)22(29)25-18-10-11-20(19(24)16-18)26-12-14-27(15-13-26)21(28)17-8-6-5-7-9-17/h5-11,16H,4,12-15H2,1-3H3,(H,25,29).
What are the key properties of N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide?
N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide has a molecular weight of 413.95 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-benzoylpiperazin-1-yl)-3-chlorophenyl]-2,2-dimethylbutanamide is sourced from PubChem (CID 45269027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).