C28H33NO3 — CID 45269091
(1S,2S,5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-ethynyl-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 45269091) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (1S,2S,5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-ethynyl-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | (1S,2S,5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-ethynyl-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 45269091 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (1S,2S,5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-ethynyl-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(N(C)C)cc3)OC[C@@]21C |
| InChI | InChI=1S/C28H33NO3/c1-5-28(31)15-14-24-23-12-8-19-16-21(30)11-13-22(19)25(23)26(32-17-27(24,28)2)18-6-9-20(10-7-18)29(3)4/h1,6-7,9-10,16,23-24,26,31H,8,11-15,17H2,2-4H3/t23-,24-,26+,27-,28-/m0/s1 |
| InChIKey | DZIWDYAOHLYJGW-DDEQHYEBSA-N |
| XLogP | 4.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|