C40H60N4O4 — CID 45269143
2,5-bis[6-[ethyl-[(1R)-1-(2-methoxyphenyl)ethyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 45269143) has the molecular formula C40H60N4O4 and a molecular weight of 660.94 g/mol. Its IUPAC name is 2,5-bis[6-[ethyl-[(1R)-1-(2-methoxyphenyl)ethyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[6-[ethyl-[(1R)-1-(2-methoxyphenyl)ethyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 45269143 |
| Molecular Formula | C40H60N4O4 |
| Molecular Weight | 660.94 g/mol |
| Exact Mass | 660.46 |
| IUPAC Name | 2,5-bis[6-[ethyl-[(1R)-1-(2-methoxyphenyl)ethyl]amino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCN(CCCCCCNC1=CC(=O)C(NCCCCCCN(CC)[C@H](C)c2ccccc2OC)=CC1=O)[C@H](C)c1ccccc1OC |
| InChI | InChI=1S/C40H60N4O4/c1-7-43(31(3)33-21-13-15-23-39(33)47-5)27-19-11-9-17-25-41-35-29-38(46)36(30-37(35)45)42-26-18-10-12-20-28-44(8-2)32(4)34-22-14-16-24-40(34)48-6/h13-16,21-24,29-32,41-42H,7-12,17-20,25-28H2,1-6H3/t31-,32-/m1/s1 |
| InChIKey | XVOJAMVHTPQUCR-ROJLCIKYSA-N |
| XLogP | 7.39 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.94 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|